Product category: pesticide intermediates
English name: N-(Hydroxymethyl)phthalimide
CAS NO: 118-29-6
Molecular weight: 177.1568
The molecular formula is C9H7NO3
InChI=1/C9H7NO3/c11-5-10-8(12)6-3-1-2-4-7(6)9(10)13/h1-4,11H,5H2
Specification: content ≥ 98.5%; Loss on drying ≤ 0.5%; The tolerance is 140-145℃
Packing: 25kg/cardboard barrel
Uses: Widely used in synthetic medicine, dye, pesticide, etc. For example, in the production of dye intermediates, 1,4- dichloroanthraquinone, 1- chloroanthraquinone, phenylindanone as an anticoagulant, and tetrachloron-hydroxymethylphthalimide as a bactericide, the anti-anxiety measures are equal.
Alias name: N- hydroxymethyl phthalimide; N- (hydroxymethyl) phthalimide; N- (hydroxymethyl) phthalimide